C24H26N8O3 — CID 118132413
1-(diaminomethylidene)-3-[[3-[2-[4-(3-methoxyphenyl)-3-oxopiperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea (PubChem CID 118132413) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[[3-[2-[4-(3-methoxyphenyl)-3-oxopiperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea.
| Compound Name | 1-(diaminomethylidene)-3-[[3-[2-[4-(3-methoxyphenyl)-3-oxopiperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 118132413 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-(diaminomethylidene)-3-[[3-[2-[4-(3-methoxyphenyl)-3-oxopiperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea |
| SMILES | COc1cccc(N2CCN(c3ncc(-c4cccc(CNC(=O)N=C(N)N)c4)cn3)CC2=O)c1 |
| InChI | InChI=1S/C24H26N8O3/c1-35-20-7-3-6-19(11-20)32-9-8-31(15-21(32)33)23-27-13-18(14-28-23)17-5-2-4-16(10-17)12-29-24(34)30-22(25)26/h2-7,10-11,13-14H,8-9,12,15H2,1H3,(H5,25,26,29,30,34) |
| InChIKey | NBUFNYUDIKDRRQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|