C25H27ClN8O3 — CID 86686265
methyl 3-chloro-4-[4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]benzoate (PubChem CID 86686265) has the molecular formula C25H27ClN8O3 and a molecular weight of 523.00 g/mol. Its IUPAC name is methyl 3-chloro-4-[4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]benzoate.
| Compound Name | methyl 3-chloro-4-[4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 86686265 |
| Molecular Formula | C25H27ClN8O3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | methyl 3-chloro-4-[4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(c3ncc(-c4cccc(CNC(=O)N=C(N)N)c4)cn3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C25H27ClN8O3/c1-37-22(35)18-5-6-21(20(26)12-18)33-7-9-34(10-8-33)24-29-14-19(15-30-24)17-4-2-3-16(11-17)13-31-25(36)32-23(27)28/h2-6,11-12,14-15H,7-10,13H2,1H3,(H5,27,28,31,32,36) |
| InChIKey | AROSBTDORGMLAL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|