C23H32N8O2 — CID 118132550
1-(diaminomethylidene)-3-[[3-[2-[[(1R,2R)-2-morpholin-4-ylcyclohexyl]amino]pyrimidin-5-yl]phenyl]methyl]urea (PubChem CID 118132550) has the molecular formula C23H32N8O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[[3-[2-[[(1R,2R)-2-morpholin-4-ylcyclohexyl]amino]pyrimidin-5-yl]phenyl]methyl]urea.
| Compound Name | 1-(diaminomethylidene)-3-[[3-[2-[[(1R,2R)-2-morpholin-4-ylcyclohexyl]amino]pyrimidin-5-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 118132550 |
| Molecular Formula | C23H32N8O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 1-(diaminomethylidene)-3-[[3-[2-[[(1R,2R)-2-morpholin-4-ylcyclohexyl]amino]pyrimidin-5-yl]phenyl]methyl]urea |
| SMILES | NC(N)=NC(=O)NCc1cccc(-c2cnc(N[C@@H]3CCCC[C@H]3N3CCOCC3)nc2)c1 |
| InChI | InChI=1S/C23H32N8O2/c24-21(25)30-23(32)28-13-16-4-3-5-17(12-16)18-14-26-22(27-15-18)29-19-6-1-2-7-20(19)31-8-10-33-11-9-31/h3-5,12,14-15,19-20H,1-2,6-11,13H2,(H,26,27,29)(H5,24,25,28,30,32)/t19-,20-/m1/s1 |
| InChIKey | HMRVLEXLNWEXBW-WOJBJXKFSA-N |
| XLogP | 1.68 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|