C17H19FN6O2 — CID 66548687
[3-[2-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 66548687) has the molecular formula C17H19FN6O2 and a molecular weight of 358.38 g/mol. Its IUPAC name is [3-[2-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[2-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 66548687 |
| Molecular Formula | C17H19FN6O2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [3-[2-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(-c2cnc(N3CC[C@H](F)C3)nc2)c1 |
| InChI | InChI=1S/C17H19FN6O2/c18-14-4-5-24(9-14)16-21-7-13(8-22-16)12-3-1-2-11(6-12)10-26-17(25)23-15(19)20/h1-3,6-8,14H,4-5,9-10H2,(H4,19,20,23,25)/t14-/m0/s1 |
| InChIKey | ISROPISOUBPAOS-AWEZNQCLSA-N |
| XLogP | 1.60 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|