C21H27FN6O3 — CID 118132380
[2-fluoro-3-[2-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]ethyl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 118132380) has the molecular formula C21H27FN6O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is [2-fluoro-3-[2-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]ethyl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[2-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]ethyl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 118132380 |
| Molecular Formula | C21H27FN6O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [2-fluoro-3-[2-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]ethyl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CC1(O)CCN(c2ncc(CCc3cccc(COC(=O)N=C(N)N)c3F)cn2)CC1 |
| InChI | InChI=1S/C21H27FN6O3/c1-21(30)7-9-28(10-8-21)19-25-11-14(12-26-19)5-6-15-3-2-4-16(17(15)22)13-31-20(29)27-18(23)24/h2-4,11-12,30H,5-10,13H2,1H3,(H4,23,24,27,29) |
| InChIKey | XWXPWFSVJQKTSB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|