C21H22FN7O7 — CID 134584850
(Z)-but-2-enedioic acid;[2-fluoro-3-[2-(3-methoxyiminoazetidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 134584850) has the molecular formula C21H22FN7O7 and a molecular weight of 503.45 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;[2-fluoro-3-[2-(3-methoxyiminoazetidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | (Z)-but-2-enedioic acid;[2-fluoro-3-[2-(3-methoxyiminoazetidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 134584850 |
| Molecular Formula | C21H22FN7O7 |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;[2-fluoro-3-[2-(3-methoxyiminoazetidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CON=C1CN(c2ncc(-c3cccc(COC(=O)N=C(N)N)c3F)cn2)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H18FN7O3.C4H4O4/c1-27-24-12-7-25(8-12)16-21-5-11(6-22-16)13-4-2-3-10(14(13)18)9-28-17(26)23-15(19)20;5-3(6)1-2-4(7)8/h2-6H,7-9H2,1H3,(H4,19,20,23,26);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QXXJWGKDGBELJN-BTJKTKAUSA-N |
| XLogP | 0.73 |
| TPSA | 215.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|