C20H22FN7O5 — CID 126562503
4-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxybutanoic acid (PubChem CID 126562503) has the molecular formula C20H22FN7O5 and a molecular weight of 459.44 g/mol. Its IUPAC name is 4-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxybutanoic acid.
| Compound Name | 4-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxybutanoic acid |
|---|---|
| PubChem CID | 126562503 |
| Molecular Formula | C20H22FN7O5 |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxybutanoic acid |
| SMILES | NC(N)=NC(=O)OCc1cccc(-c2cnc(N3CC(=NOCCCC(=O)O)C3)nc2)c1F |
| InChI | InChI=1S/C20H22FN7O5/c21-17-12(11-32-20(31)26-18(22)23)3-1-4-15(17)13-7-24-19(25-8-13)28-9-14(10-28)27-33-6-2-5-16(29)30/h1,3-4,7-8H,2,5-6,9-11H2,(H,29,30)(H4,22,23,26,31) |
| InChIKey | RXVOUTRJEGIQIY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 178.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|