C23H27FN8O5 — CID 126562097
[2-fluoro-3-[2-[4-[2-(2-oxo-1,3-oxazolidin-3-yl)ethoxyimino]piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 126562097) has the molecular formula C23H27FN8O5 and a molecular weight of 514.52 g/mol. Its IUPAC name is [2-fluoro-3-[2-[4-[2-(2-oxo-1,3-oxazolidin-3-yl)ethoxyimino]piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[2-[4-[2-(2-oxo-1,3-oxazolidin-3-yl)ethoxyimino]piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 126562097 |
| Molecular Formula | C23H27FN8O5 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [2-fluoro-3-[2-[4-[2-(2-oxo-1,3-oxazolidin-3-yl)ethoxyimino]piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(-c2cnc(N3CCC(=NOCCN4CCOC4=O)CC3)nc2)c1F |
| InChI | InChI=1S/C23H27FN8O5/c24-19-15(14-36-22(33)29-20(25)26)2-1-3-18(19)16-12-27-21(28-13-16)31-6-4-17(5-7-31)30-37-11-9-32-8-10-35-23(32)34/h1-3,12-13H,4-11,14H2,(H4,25,26,29,33) |
| InChIKey | PUTAIJKBOOTOIC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|