C21H24FN7O6 — CID 126562870
[2-[[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]-3-hydroxypropyl] formate (PubChem CID 126562870) has the molecular formula C21H24FN7O6 and a molecular weight of 489.46 g/mol. Its IUPAC name is [2-[[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]-3-hydroxypropyl] formate.
| Compound Name | [2-[[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]-3-hydroxypropyl] formate |
|---|---|
| PubChem CID | 126562870 |
| Molecular Formula | C21H24FN7O6 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [2-[[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]-3-hydroxypropyl] formate |
| SMILES | NC(N)=NC(=O)OCc1cccc(-c2cnc(N3CC(=NOCC(CO)COC=O)C3)nc2)c1F |
| InChI | InChI=1S/C21H24FN7O6/c22-18-14(11-34-21(32)27-19(23)24)2-1-3-17(18)15-4-25-20(26-5-15)29-6-16(7-29)28-35-10-13(8-30)9-33-12-31/h1-5,12-13,30H,6-11H2,(H4,23,24,27,32) |
| InChIKey | GAHZTBJTTFXLNC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 187.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|