C22H27FN8O4 — CID 146027223
[2-fluoro-3-[2-[3-(1-morpholin-4-ylethoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146027223) has the molecular formula C22H27FN8O4 and a molecular weight of 486.51 g/mol. Its IUPAC name is [2-fluoro-3-[2-[3-(1-morpholin-4-ylethoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[2-[3-(1-morpholin-4-ylethoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146027223 |
| Molecular Formula | C22H27FN8O4 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [2-fluoro-3-[2-[3-(1-morpholin-4-ylethoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CC(ON=C1CN(c2ncc(-c3cccc(COC(=O)N=C(N)N)c3F)cn2)C1)N1CCOCC1 |
| InChI | InChI=1S/C22H27FN8O4/c1-14(30-5-7-33-8-6-30)35-29-17-11-31(12-17)21-26-9-16(10-27-21)18-4-2-3-15(19(18)23)13-34-22(32)28-20(24)25/h2-4,9-10,14H,5-8,11-13H2,1H3,(H4,24,25,28,32) |
| InChIKey | VBQTZJHWHWZHMR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|