C26H35FN8O5 — CID 126561764
tert-butyl N-[2-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]piperidin-4-ylidene]amino]oxyethyl]-N-methylcarbamate (PubChem CID 126561764) has the molecular formula C26H35FN8O5 and a molecular weight of 558.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]piperidin-4-ylidene]amino]oxyethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]piperidin-4-ylidene]amino]oxyethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 126561764 |
| Molecular Formula | C26H35FN8O5 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | tert-butyl N-[2-[[1-[5-[3-(diaminomethylidenecarbamoyloxymethyl)-2-fluorophenyl]pyrimidin-2-yl]piperidin-4-ylidene]amino]oxyethyl]-N-methylcarbamate |
| SMILES | CN(CCON=C1CCN(c2ncc(-c3cccc(COC(=O)N=C(N)N)c3F)cn2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35FN8O5/c1-26(2,3)40-25(37)34(4)12-13-39-33-19-8-10-35(11-9-19)23-30-14-18(15-31-23)20-7-5-6-17(21(20)27)16-38-24(36)32-22(28)29/h5-7,14-15H,8-13,16H2,1-4H3,(H4,28,29,32,36) |
| InChIKey | BDILUANMTUESKR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|