C23H28FN7O4 — CID 158652774
[3-[2-[4-(2-acetamidoethoxyimino)piperidin-1-yl]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 158652774) has the molecular formula C23H28FN7O4 and a molecular weight of 485.52 g/mol. Its IUPAC name is [3-[2-[4-(2-acetamidoethoxyimino)piperidin-1-yl]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [3-[2-[4-(2-acetamidoethoxyimino)piperidin-1-yl]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 158652774 |
| Molecular Formula | C23H28FN7O4 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [3-[2-[4-(2-acetamidoethoxyimino)piperidin-1-yl]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(N3CCC(=NOCCNC(C)=O)CC3)nc2)c1F |
| InChI | InChI=1S/C23H28FN7O4/c1-15(32)27-7-10-35-30-18-5-8-31(9-6-18)23-28-12-17(13-29-23)19-4-2-3-16(22(19)24)14-34-21(33)11-20(25)26/h2-4,12-13H,5-11,14H2,1H3,(H3,25,26)(H,27,32) |
| InChIKey | IBTHLRGEWOQXTP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 155.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|