C22H28FN7O4 — CID 126562062
[2-fluoro-3-[2-[4-(4-hydroxybutoxyimino)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 126562062) has the molecular formula C22H28FN7O4 and a molecular weight of 473.51 g/mol. Its IUPAC name is [2-fluoro-3-[2-[4-(4-hydroxybutoxyimino)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[2-[4-(4-hydroxybutoxyimino)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 126562062 |
| Molecular Formula | C22H28FN7O4 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [2-fluoro-3-[2-[4-(4-hydroxybutoxyimino)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(-c2cnc(N3CCC(=NOCCCCO)CC3)nc2)c1F |
| InChI | InChI=1S/C22H28FN7O4/c23-19-15(14-33-22(32)28-20(24)25)4-3-5-18(19)16-12-26-21(27-13-16)30-8-6-17(7-9-30)29-34-11-2-1-10-31/h3-5,12-13,31H,1-2,6-11,14H2,(H4,24,25,28,32) |
| InChIKey | HOFJIKKPEGDQLO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 161.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|