C20H23FN6O4 — CID 158214988
[2-fluoro-3-[2-[3-(3-hydroxypropoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 158214988) has the molecular formula C20H23FN6O4 and a molecular weight of 430.44 g/mol. Its IUPAC name is [2-fluoro-3-[2-[3-(3-hydroxypropoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[2-[3-(3-hydroxypropoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 158214988 |
| Molecular Formula | C20H23FN6O4 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [2-fluoro-3-[2-[3-(3-hydroxypropoxyimino)azetidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(N3CC(=NOCCCO)C3)nc2)c1F |
| InChI | InChI=1S/C20H23FN6O4/c21-19-13(12-30-18(29)7-17(22)23)3-1-4-16(19)14-8-24-20(25-9-14)27-10-15(11-27)26-31-6-2-5-28/h1,3-4,8-9,28H,2,5-7,10-12H2,(H3,22,23) |
| InChIKey | GCNRTLPPVKOHIY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 147.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|