C24H31FN6O4 — CID 158286346
[2-fluoro-3-[2-[4-(3-hydroxy-2,2-dimethylpropoxy)iminopiperidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 158286346) has the molecular formula C24H31FN6O4 and a molecular weight of 486.55 g/mol. Its IUPAC name is [2-fluoro-3-[2-[4-(3-hydroxy-2,2-dimethylpropoxy)iminopiperidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[2-[4-(3-hydroxy-2,2-dimethylpropoxy)iminopiperidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 158286346 |
| Molecular Formula | C24H31FN6O4 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [2-fluoro-3-[2-[4-(3-hydroxy-2,2-dimethylpropoxy)iminopiperidin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(N3CCC(=NOCC(C)(C)CO)CC3)nc2)c1F |
| InChI | InChI=1S/C24H31FN6O4/c1-24(2,14-32)15-35-30-18-6-8-31(9-7-18)23-28-11-17(12-29-23)19-5-3-4-16(22(19)25)13-34-21(33)10-20(26)27/h3-5,11-12,32H,6-10,13-15H2,1-2H3,(H3,26,27) |
| InChIKey | GKVCJXWFFSIFKZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 147.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|