C24H24FN7O3 — CID 126562095
[2-fluoro-3-[2-(4-phenoxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 126562095) has the molecular formula C24H24FN7O3 and a molecular weight of 477.50 g/mol. Its IUPAC name is [2-fluoro-3-[2-(4-phenoxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[2-(4-phenoxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 126562095 |
| Molecular Formula | C24H24FN7O3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [2-fluoro-3-[2-(4-phenoxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(-c2cnc(N3CCC(=NOc4ccccc4)CC3)nc2)c1F |
| InChI | InChI=1S/C24H24FN7O3/c25-21-16(15-34-24(33)30-22(26)27)5-4-8-20(21)17-13-28-23(29-14-17)32-11-9-18(10-12-32)31-35-19-6-2-1-3-7-19/h1-8,13-14H,9-12,15H2,(H4,26,27,30,33) |
| InChIKey | YOHSJFUUAJVHCG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|