C20H23FN8O3S — CID 126562077
[2-fluoro-3-[2-[3-(1-methylsulfanylazetidin-3-yl)oxyiminoazetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 126562077) has the molecular formula C20H23FN8O3S and a molecular weight of 474.52 g/mol. Its IUPAC name is [2-fluoro-3-[2-[3-(1-methylsulfanylazetidin-3-yl)oxyiminoazetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[2-[3-(1-methylsulfanylazetidin-3-yl)oxyiminoazetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 126562077 |
| Molecular Formula | C20H23FN8O3S |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [2-fluoro-3-[2-[3-(1-methylsulfanylazetidin-3-yl)oxyiminoazetidin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CSN1CC(ON=C2CN(c3ncc(-c4cccc(COC(=O)N=C(N)N)c4F)cn3)C2)C1 |
| InChI | InChI=1S/C20H23FN8O3S/c1-33-29-9-15(10-29)32-27-14-7-28(8-14)19-24-5-13(6-25-19)16-4-2-3-12(17(16)21)11-31-20(30)26-18(22)23/h2-6,15H,7-11H2,1H3,(H4,22,23,26,30) |
| InChIKey | PCVJUZLQQKLZOU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 144.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|