C19H19F3N6O3 — CID 126564583
[3-[5-(difluoromethyl)-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 126564583) has the molecular formula C19H19F3N6O3 and a molecular weight of 436.39 g/mol. Its IUPAC name is [3-[5-(difluoromethyl)-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[5-(difluoromethyl)-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 126564583 |
| Molecular Formula | C19H19F3N6O3 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [3-[5-(difluoromethyl)-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CON=C1CN(c2ncc(-c3cccc(COC(=O)N=C(N)N)c3F)cc2C(F)F)C1 |
| InChI | InChI=1S/C19H19F3N6O3/c1-30-27-12-7-28(8-12)17-14(16(21)22)5-11(6-25-17)13-4-2-3-10(15(13)20)9-31-19(29)26-18(23)24/h2-6,16H,7-9H2,1H3,(H4,23,24,26,29) |
| InChIKey | ICAGEPWOICYEEX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|