C24H26F2N6O5 — CID 146032297
[3-[6-[3-[2-(2,2-dimethyl-1,3-dioxol-4-yl)ethoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146032297) has the molecular formula C24H26F2N6O5 and a molecular weight of 516.51 g/mol. Its IUPAC name is [3-[6-[3-[2-(2,2-dimethyl-1,3-dioxol-4-yl)ethoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[6-[3-[2-(2,2-dimethyl-1,3-dioxol-4-yl)ethoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146032297 |
| Molecular Formula | C24H26F2N6O5 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [3-[6-[3-[2-(2,2-dimethyl-1,3-dioxol-4-yl)ethoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CC1(C)OC=C(CCON=C2CN(c3ncc(-c4cccc(COC(=O)N=C(N)N)c4F)cc3F)C2)O1 |
| InChI | InChI=1S/C24H26F2N6O5/c1-24(2)35-13-17(37-24)6-7-36-31-16-10-32(11-16)21-19(25)8-15(9-29-21)18-5-3-4-14(20(18)26)12-34-23(33)30-22(27)28/h3-5,8-9,13H,6-7,10-12H2,1-2H3,(H4,27,28,30,33) |
| InChIKey | VFDOUMHDFXHDAF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|