C19H21F2N5O4 — CID 135200663
[3-[6-(3,3-dimethoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 135200663) has the molecular formula C19H21F2N5O4 and a molecular weight of 421.40 g/mol. Its IUPAC name is [3-[6-(3,3-dimethoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[6-(3,3-dimethoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 135200663 |
| Molecular Formula | C19H21F2N5O4 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [3-[6-(3,3-dimethoxyazetidin-1-yl)-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | COC1(OC)CN(c2ncc(-c3cccc(COC(=O)N=C(N)N)c3F)cc2F)C1 |
| InChI | InChI=1S/C19H21F2N5O4/c1-28-19(29-2)9-26(10-19)16-14(20)6-12(7-24-16)13-5-3-4-11(15(13)21)8-30-18(27)25-17(22)23/h3-7H,8-10H2,1-2H3,(H4,22,23,25,27) |
| InChIKey | BNYZFTJWTZECJR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|