C24H32FN7O4 — CID 118132650
[3-[2-[[1-(diethylcarbamoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 118132650) has the molecular formula C24H32FN7O4 and a molecular weight of 501.56 g/mol. Its IUPAC name is [3-[2-[[1-(diethylcarbamoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[2-[[1-(diethylcarbamoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 118132650 |
| Molecular Formula | C24H32FN7O4 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [3-[2-[[1-(diethylcarbamoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CCN(CC)C(=O)N1CCC(COc2ncc(-c3cccc(COC(=O)N=C(N)N)c3F)cn2)CC1 |
| InChI | InChI=1S/C24H32FN7O4/c1-3-31(4-2)24(34)32-10-8-16(9-11-32)14-35-22-28-12-18(13-29-22)19-7-5-6-17(20(19)25)15-36-23(33)30-21(26)27/h5-7,12-13,16H,3-4,8-11,14-15H2,1-2H3,(H4,26,27,30,33) |
| InChIKey | UWKPHLMBXCESBE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|