C25H32FN5O4 — CID 149068270
[2-fluoro-3-[2-[(1-pentanoylpiperidin-4-yl)methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 149068270) has the molecular formula C25H32FN5O4 and a molecular weight of 485.56 g/mol. Its IUPAC name is [2-fluoro-3-[2-[(1-pentanoylpiperidin-4-yl)methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[2-[(1-pentanoylpiperidin-4-yl)methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 149068270 |
| Molecular Formula | C25H32FN5O4 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | [2-fluoro-3-[2-[(1-pentanoylpiperidin-4-yl)methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(OCC3CCN(C(=O)CCCC)CC3)nc2)c1F |
| InChI | InChI=1S/C25H32FN5O4/c1-2-3-7-22(32)31-10-8-17(9-11-31)15-35-25-29-13-19(14-30-25)20-6-4-5-18(24(20)26)16-34-23(33)12-21(27)28/h4-6,13-14,17H,2-3,7-12,15-16H2,1H3,(H3,27,28) |
| InChIKey | QNGQMTGRXVQVDI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|