C26H36FN5O4 — CID 158461126
[2-fluoro-3-[2-[[1-(3-methylbutanoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane (PubChem CID 158461126) has the molecular formula C26H36FN5O4 and a molecular weight of 501.60 g/mol. Its IUPAC name is [2-fluoro-3-[2-[[1-(3-methylbutanoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane.
| Compound Name | [2-fluoro-3-[2-[[1-(3-methylbutanoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
|---|---|
| PubChem CID | 158461126 |
| Molecular Formula | C26H36FN5O4 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | [2-fluoro-3-[2-[[1-(3-methylbutanoyl)piperidin-4-yl]methoxy]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
| SMILES | C.[H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(OCC3CCN(C(=O)CC(C)C)CC3)nc2)c1F |
| InChI | InChI=1S/C25H32FN5O4.CH4/c1-16(2)10-22(32)31-8-6-17(7-9-31)14-35-25-29-12-19(13-30-25)20-5-3-4-18(24(20)26)15-34-23(33)11-21(27)28;/h3-5,12-13,16-17H,6-11,14-15H2,1-2H3,(H3,27,28);1H4 |
| InChIKey | HFEMEXPMSRJPPI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|