C17H25FN4O3 — CID 162018073
[3-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;methane (PubChem CID 162018073) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is [3-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;methane.
| Compound Name | [3-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;methane |
|---|---|
| PubChem CID | 162018073 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [3-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;methane |
| SMILES | C.[H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(C(C)=O)CC2)c1F |
| InChI | InChI=1S/C16H21FN4O3.CH4/c1-11(22)20-5-7-21(8-6-20)13-4-2-3-12(16(13)17)10-24-15(23)9-14(18)19;/h2-4H,5-10H2,1H3,(H3,18,19);1H4 |
| InChIKey | YUJOUZMDGFPFSC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|