C17H25FN4O4S — CID 157069337
[2-fluoro-3-(4-propylsulfonylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 157069337) has the molecular formula C17H25FN4O4S and a molecular weight of 400.48 g/mol. Its IUPAC name is [2-fluoro-3-(4-propylsulfonylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-(4-propylsulfonylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 157069337 |
| Molecular Formula | C17H25FN4O4S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [2-fluoro-3-(4-propylsulfonylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(S(=O)(=O)CCC)CC2)c1F |
| InChI | InChI=1S/C17H25FN4O4S/c1-2-10-27(24,25)22-8-6-21(7-9-22)14-5-3-4-13(17(14)18)12-26-16(23)11-15(19)20/h3-5H,2,6-12H2,1H3,(H3,19,20) |
| InChIKey | ACFYAOYHJOTVIY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|