C21H29FN4O4 — CID 157280624
[2-fluoro-3-[(3S)-3-methyl-4-(oxane-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 157280624) has the molecular formula C21H29FN4O4 and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-fluoro-3-[(3S)-3-methyl-4-(oxane-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[(3S)-3-methyl-4-(oxane-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 157280624 |
| Molecular Formula | C21H29FN4O4 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [2-fluoro-3-[(3S)-3-methyl-4-(oxane-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(C(=O)C3CCOCC3)[C@@H](C)C2)c1F |
| InChI | InChI=1S/C21H29FN4O4/c1-14-12-25(7-8-26(14)21(28)15-5-9-29-10-6-15)17-4-2-3-16(20(17)22)13-30-19(27)11-18(23)24/h2-4,14-15H,5-13H2,1H3,(H3,23,24)/t14-/m0/s1 |
| InChIKey | AZPUNNJQPIUFGF-AWEZNQCLSA-N |
| XLogP | 1.66 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|