C23H35FN4O4 — CID 162035222
[2-fluoro-3-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane (PubChem CID 162035222) has the molecular formula C23H35FN4O4 and a molecular weight of 450.56 g/mol. Its IUPAC name is [2-fluoro-3-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane.
| Compound Name | [2-fluoro-3-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
|---|---|
| PubChem CID | 162035222 |
| Molecular Formula | C23H35FN4O4 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [2-fluoro-3-[4-(4-methoxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
| SMILES | C.[H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(C(=O)C3CCC(OC)CC3)CC2)c1F |
| InChI | InChI=1S/C22H31FN4O4.CH4/c1-30-17-7-5-15(6-8-17)22(29)27-11-9-26(10-12-27)18-4-2-3-16(21(18)23)14-31-20(28)13-19(24)25;/h2-4,15,17H,5-14H2,1H3,(H3,24,25);1H4 |
| InChIKey | YWOCXRVCOLRTOJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|