C25H36FN7O3 — CID 159063409
[2-fluoro-3-[4-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane (PubChem CID 159063409) has the molecular formula C25H36FN7O3 and a molecular weight of 501.61 g/mol. Its IUPAC name is [2-fluoro-3-[4-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane.
| Compound Name | [2-fluoro-3-[4-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
|---|---|
| PubChem CID | 159063409 |
| Molecular Formula | C25H36FN7O3 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | [2-fluoro-3-[4-[2-(4-hydroxy-4-methylpiperidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
| SMILES | C.[H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(c3cnc(N4CCC(C)(O)CC4)nc3)CC2)c1F |
| InChI | InChI=1S/C24H32FN7O3.CH4/c1-24(34)5-7-32(8-6-24)23-28-14-18(15-29-23)30-9-11-31(12-10-30)19-4-2-3-17(22(19)25)16-35-21(33)13-20(26)27;/h2-4,14-15,34H,5-13,16H2,1H3,(H3,26,27);1H4 |
| InChIKey | JYTGREFVBCFYAP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|