C24H32FN7O4 — CID 157087553
[2-fluoro-3-[4-[2-[3-(2-methoxyethoxy)azetidin-1-yl]pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 157087553) has the molecular formula C24H32FN7O4 and a molecular weight of 501.56 g/mol. Its IUPAC name is [2-fluoro-3-[4-[2-[3-(2-methoxyethoxy)azetidin-1-yl]pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[4-[2-[3-(2-methoxyethoxy)azetidin-1-yl]pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 157087553 |
| Molecular Formula | C24H32FN7O4 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [2-fluoro-3-[4-[2-[3-(2-methoxyethoxy)azetidin-1-yl]pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(c3cnc(N4CC(OCCOC)C4)nc3)CC2)c1F |
| InChI | InChI=1S/C24H32FN7O4/c1-34-9-10-35-19-14-32(15-19)24-28-12-18(13-29-24)30-5-7-31(8-6-30)20-4-2-3-17(23(20)25)16-36-22(33)11-21(26)27/h2-4,12-13,19H,5-11,14-16H2,1H3,(H3,26,27) |
| InChIKey | AEGQYFOVHNVIMY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|