C20H23FN4O4 — CID 134819762
[2-fluoro-3-[3-[[6-(methoxymethyl)-3-pyridinyl]oxy]azetidin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 134819762) has the molecular formula C20H23FN4O4 and a molecular weight of 402.43 g/mol. Its IUPAC name is [2-fluoro-3-[3-[[6-(methoxymethyl)-3-pyridinyl]oxy]azetidin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[3-[[6-(methoxymethyl)-3-pyridinyl]oxy]azetidin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 134819762 |
| Molecular Formula | C20H23FN4O4 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [2-fluoro-3-[3-[[6-(methoxymethyl)-3-pyridinyl]oxy]azetidin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CC(Oc3ccc(COC)nc3)C2)c1F |
| InChI | InChI=1S/C20H23FN4O4/c1-27-12-14-5-6-15(8-24-14)29-16-9-25(10-16)17-4-2-3-13(20(17)21)11-28-19(26)7-18(22)23/h2-6,8,16H,7,9-12H2,1H3,(H3,22,23) |
| InChIKey | IMABHUYSGDSTLN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|