C21H28FN5O2 — CID 158948301
[2-fluoro-3-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane (PubChem CID 158948301) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is [2-fluoro-3-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane.
| Compound Name | [2-fluoro-3-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
|---|---|
| PubChem CID | 158948301 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [2-fluoro-3-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
| SMILES | C.[H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(c3cccc(C)n3)CC2)c1F |
| InChI | InChI=1S/C20H24FN5O2.CH4/c1-14-4-2-7-18(24-14)26-10-8-25(9-11-26)16-6-3-5-15(20(16)21)13-28-19(27)12-17(22)23;/h2-7H,8-13H2,1H3,(H3,22,23);1H4 |
| InChIKey | JLCJRAJVNMENMI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|