C21H29FN4O4 — CID 147394998
[2-fluoro-3-[4-(4-hydroxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 147394998) has the molecular formula C21H29FN4O4 and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-fluoro-3-[4-(4-hydroxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[4-(4-hydroxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 147394998 |
| Molecular Formula | C21H29FN4O4 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [2-fluoro-3-[4-(4-hydroxycyclohexanecarbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(C(=O)C3CCC(O)CC3)CC2)c1F |
| InChI | InChI=1S/C21H29FN4O4/c22-20-15(13-30-19(28)12-18(23)24)2-1-3-17(20)25-8-10-26(11-9-25)21(29)14-4-6-16(27)7-5-14/h1-3,14,16,27H,4-13H2,(H3,23,24) |
| InChIKey | DNPSGVFKHFXMGJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|