C20H29FN4O4 — CID 147325830
[2-fluoro-3-[4-(3-methoxypropanoyl)-3,3-dimethylpiperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 147325830) has the molecular formula C20H29FN4O4 and a molecular weight of 408.47 g/mol. Its IUPAC name is [2-fluoro-3-[4-(3-methoxypropanoyl)-3,3-dimethylpiperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[4-(3-methoxypropanoyl)-3,3-dimethylpiperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 147325830 |
| Molecular Formula | C20H29FN4O4 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [2-fluoro-3-[4-(3-methoxypropanoyl)-3,3-dimethylpiperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(C(=O)CCOC)C(C)(C)C2)c1F |
| InChI | InChI=1S/C20H29FN4O4/c1-20(2)13-24(8-9-25(20)17(26)7-10-28-3)15-6-4-5-14(19(15)21)12-29-18(27)11-16(22)23/h4-6H,7-13H2,1-3H3,(H3,22,23) |
| InChIKey | DARSMQLWXRYNQU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|