C21H30FN5O3 — CID 146708648
[2-fluoro-3-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 146708648) has the molecular formula C21H30FN5O3 and a molecular weight of 419.50 g/mol. Its IUPAC name is [2-fluoro-3-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 146708648 |
| Molecular Formula | C21H30FN5O3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | [2-fluoro-3-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(C(=O)C3CCN(C)CC3)CC2)c1F |
| InChI | InChI=1S/C21H30FN5O3/c1-25-7-5-15(6-8-25)21(29)27-11-9-26(10-12-27)17-4-2-3-16(20(17)22)14-30-19(28)13-18(23)24/h2-4,15H,5-14H2,1H3,(H3,23,24) |
| InChIKey | RAEQNTCUWNJURL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|