C21H27FN8O3 — CID 118112352
[N'-[[2-fluoro-3-[4-[2-(3-methoxyazetidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl]carbamimidoyl]carbamic acid (PubChem CID 118112352) has the molecular formula C21H27FN8O3 and a molecular weight of 458.50 g/mol. Its IUPAC name is [N'-[[2-fluoro-3-[4-[2-(3-methoxyazetidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl]carbamimidoyl]carbamic acid.
| Compound Name | [N'-[[2-fluoro-3-[4-[2-(3-methoxyazetidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 118112352 |
| Molecular Formula | C21H27FN8O3 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [N'-[[2-fluoro-3-[4-[2-(3-methoxyazetidin-1-yl)pyrimidin-5-yl]piperazin-1-yl]phenyl]methyl]carbamimidoyl]carbamic acid |
| SMILES | COC1CN(c2ncc(N3CCN(c4cccc(C/N=C(\N)NC(=O)O)c4F)CC3)cn2)C1 |
| InChI | InChI=1S/C21H27FN8O3/c1-33-16-12-30(13-16)20-25-10-15(11-26-20)28-5-7-29(8-6-28)17-4-2-3-14(18(17)22)9-24-19(23)27-21(31)32/h2-4,10-11,16H,5-9,12-13H2,1H3,(H,31,32)(H3,23,24,27) |
| InChIKey | PBGWETSMEAMZSY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|