C20H24FN5O2 — CID 88931442
1-[2-fluoro-3-(nitrosomethyl)phenyl]-4-[6-(3-methoxyazetidin-1-yl)-3-pyridinyl]piperazine (PubChem CID 88931442) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-[2-fluoro-3-(nitrosomethyl)phenyl]-4-[6-(3-methoxyazetidin-1-yl)-3-pyridinyl]piperazine.
| Compound Name | 1-[2-fluoro-3-(nitrosomethyl)phenyl]-4-[6-(3-methoxyazetidin-1-yl)-3-pyridinyl]piperazine |
|---|---|
| PubChem CID | 88931442 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-[2-fluoro-3-(nitrosomethyl)phenyl]-4-[6-(3-methoxyazetidin-1-yl)-3-pyridinyl]piperazine |
| SMILES | COC1CN(c2ccc(N3CCN(c4cccc(CN=O)c4F)CC3)cn2)C1 |
| InChI | InChI=1S/C20H24FN5O2/c1-28-17-13-26(14-17)19-6-5-16(12-22-19)24-7-9-25(10-8-24)18-4-2-3-15(11-23-27)20(18)21/h2-6,12,17H,7-11,13-14H2,1H3 |
| InChIKey | NENYYSQLBHHNJN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |