C20H23FN6O3 — CID 146028278
[3-[4-(4-carbamoylphenyl)piperazin-1-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146028278) has the molecular formula C20H23FN6O3 and a molecular weight of 414.44 g/mol. Its IUPAC name is [3-[4-(4-carbamoylphenyl)piperazin-1-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[4-(4-carbamoylphenyl)piperazin-1-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146028278 |
| Molecular Formula | C20H23FN6O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [3-[4-(4-carbamoylphenyl)piperazin-1-yl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(=O)c1ccc(N2CCN(c3cccc(COC(=O)N=C(N)N)c3F)CC2)cc1 |
| InChI | InChI=1S/C20H23FN6O3/c21-17-14(12-30-20(29)25-19(23)24)2-1-3-16(17)27-10-8-26(9-11-27)15-6-4-13(5-7-15)18(22)28/h1-7H,8-12H2,(H2,22,28)(H4,23,24,25,29) |
| InChIKey | MZVXYZSKQNMSRB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|