C20H22FN7O2 — CID 66546394
[2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 66546394) has the molecular formula C20H22FN7O2 and a molecular weight of 411.44 g/mol. Its IUPAC name is [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 66546394 |
| Molecular Formula | C20H22FN7O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(N2CCN(c3ccn4ccnc4c3)CC2)c1F |
| InChI | InChI=1S/C20H22FN7O2/c21-18-14(13-30-20(29)25-19(22)23)2-1-3-16(18)27-10-8-26(9-11-27)15-4-6-28-7-5-24-17(28)12-15/h1-7,12H,8-11,13H2,(H4,22,23,25,29) |
| InChIKey | CHZYFZJLLZRBAZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|