C19H21FN6O3 — CID 118132394
[2-fluoro-3-[3-oxo-4-(pyridin-3-ylmethyl)piperazin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 118132394) has the molecular formula C19H21FN6O3 and a molecular weight of 400.41 g/mol. Its IUPAC name is [2-fluoro-3-[3-oxo-4-(pyridin-3-ylmethyl)piperazin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[3-oxo-4-(pyridin-3-ylmethyl)piperazin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 118132394 |
| Molecular Formula | C19H21FN6O3 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [2-fluoro-3-[3-oxo-4-(pyridin-3-ylmethyl)piperazin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(N2CCN(Cc3cccnc3)C(=O)C2)c1F |
| InChI | InChI=1S/C19H21FN6O3/c20-17-14(12-29-19(28)24-18(21)22)4-1-5-15(17)25-7-8-26(16(27)11-25)10-13-3-2-6-23-9-13/h1-6,9H,7-8,10-12H2,(H4,21,22,24,28) |
| InChIKey | HPIMVYZWLXQXEQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|