C19H20FN5O2 — CID 146028331
[3-fluoro-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146028331) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is [3-fluoro-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-fluoro-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146028331 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [3-fluoro-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1ccnc(N2CC=C(c3ccccc3)CC2)c1F |
| InChI | InChI=1S/C19H20FN5O2/c20-16-15(12-27-19(26)24-18(21)22)6-9-23-17(16)25-10-7-14(8-11-25)13-4-2-1-3-5-13/h1-7,9H,8,10-12H2,(H4,21,22,24,26) |
| InChIKey | HJJLTONTFIWIJY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|