C20H26N4O2 — CID 67281606
[1-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butyl] carbamate (PubChem CID 67281606) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is [1-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butyl] carbamate.
| Compound Name | [1-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butyl] carbamate |
|---|---|
| PubChem CID | 67281606 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [1-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butyl] carbamate |
| SMILES | NC(=O)OC(CCCN1CCN(c2ccccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H26N4O2/c21-20(25)26-18(17-7-2-1-3-8-17)9-6-12-23-13-15-24(16-14-23)19-10-4-5-11-22-19/h1-5,7-8,10-11,18H,6,9,12-16H2,(H2,21,25) |
| InChIKey | KMPZINBUQUOENH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |