C25H26F3N3O — CID 11797416
1-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]-4-pyridin-2-ylpiperazine (PubChem CID 11797416) has the molecular formula C25H26F3N3O and a molecular weight of 441.50 g/mol. Its IUPAC name is 1-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]-4-pyridin-2-ylpiperazine.
| Compound Name | 1-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 11797416 |
| Molecular Formula | C25H26F3N3O |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 1-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]-4-pyridin-2-ylpiperazine |
| SMILES | FC(F)(F)c1ccc(OC(CCN2CCN(c3ccccn3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26F3N3O/c26-25(27,28)21-9-11-22(12-10-21)32-23(20-6-2-1-3-7-20)13-15-30-16-18-31(19-17-30)24-8-4-5-14-29-24/h1-12,14,23H,13,15-19H2 |
| InChIKey | BFUZKYZYAVZLHQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |