C26H24F6N2O — CID 11512090
1-[2-phenyl-2-[4-(trifluoromethyl)phenoxy]ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 11512090) has the molecular formula C26H24F6N2O and a molecular weight of 494.48 g/mol. Its IUPAC name is 1-[2-phenyl-2-[4-(trifluoromethyl)phenoxy]ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[2-phenyl-2-[4-(trifluoromethyl)phenoxy]ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 11512090 |
| Molecular Formula | C26H24F6N2O |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 1-[2-phenyl-2-[4-(trifluoromethyl)phenoxy]ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1ccc(OC(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24F6N2O/c27-25(28,29)20-9-11-23(12-10-20)35-24(19-5-2-1-3-6-19)18-33-13-15-34(16-14-33)22-8-4-7-21(17-22)26(30,31)32/h1-12,17,24H,13-16,18H2 |
| InChIKey | ZLGROMLSPZUKKZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |