C21H26F3N3O — CID 71774827
1-[4-(dimethylamino)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanol (PubChem CID 71774827) has the molecular formula C21H26F3N3O and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanol.
| Compound Name | 1-[4-(dimethylamino)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 71774827 |
| Molecular Formula | C21H26F3N3O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanol |
| SMILES | CN(C)c1ccc(C(O)CN2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26F3N3O/c1-25(2)18-8-6-16(7-9-18)20(28)15-26-10-12-27(13-11-26)19-5-3-4-17(14-19)21(22,23)24/h3-9,14,20,28H,10-13,15H2,1-2H3 |
| InChIKey | UWQSMRLGLGYBMR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|