C41H44F6N4O — CID 174639757
2,4-bis(3-methylphenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one (PubChem CID 174639757) has the molecular formula C41H44F6N4O and a molecular weight of 722.82 g/mol. Its IUPAC name is 2,4-bis(3-methylphenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one.
| Compound Name | 2,4-bis(3-methylphenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 174639757 |
| Molecular Formula | C41H44F6N4O |
| Molecular Weight | 722.82 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | 2,4-bis(3-methylphenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one |
| SMILES | Cc1cccc(C(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)C(=O)C(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C41H44F6N4O/c1-29-7-3-9-31(23-29)37(27-48-15-19-50(20-16-48)35-13-5-11-33(25-35)40(42,43)44)39(52)38(32-10-4-8-30(2)24-32)28-49-17-21-51(22-18-49)36-14-6-12-34(26-36)41(45,46)47/h3-14,23-26,37-38H,15-22,27-28H2,1-2H3 |
| InChIKey | BNRKBGAAPXIVOP-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.82 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |