C39H38F6N6O5 — CID 174639615
2,4-bis(2-nitrophenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one (PubChem CID 174639615) has the molecular formula C39H38F6N6O5 and a molecular weight of 784.76 g/mol. Its IUPAC name is 2,4-bis(2-nitrophenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one.
| Compound Name | 2,4-bis(2-nitrophenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 174639615 |
| Molecular Formula | C39H38F6N6O5 |
| Molecular Weight | 784.76 g/mol |
| Exact Mass | 784.28 |
| IUPAC Name | 2,4-bis(2-nitrophenyl)-1,5-bis[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentan-3-one |
| SMILES | O=C(C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccccc1[N+](=O)[O-])C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C39H38F6N6O5/c40-38(41,42)27-7-5-9-29(23-27)48-19-15-46(16-20-48)25-33(31-11-1-3-13-35(31)50(53)54)37(52)34(32-12-2-4-14-36(32)51(55)56)26-47-17-21-49(22-18-47)30-10-6-8-28(24-30)39(43,44)45/h1-14,23-24,33-34H,15-22,25-26H2 |
| InChIKey | WHQUSOWNWKOMPA-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 116.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.76 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|