C19H20F3NO — CID 117068544
1-[2-phenyl-2-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine (PubChem CID 117068544) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is 1-[2-phenyl-2-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-phenyl-2-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 117068544 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[2-phenyl-2-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine |
| SMILES | FC(F)(F)c1cccc(OC(CN2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H20F3NO/c20-19(21,22)16-9-6-10-17(13-16)24-18(14-23-11-4-5-12-23)15-7-2-1-3-8-15/h1-3,6-10,13,18H,4-5,11-12,14H2 |
| InChIKey | QXBFSKMCWGOYSU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |