C17H21FN8O3 — CID 146028341
[3-fluoro-2-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146028341) has the molecular formula C17H21FN8O3 and a molecular weight of 404.41 g/mol. Its IUPAC name is [3-fluoro-2-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-fluoro-2-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146028341 |
| Molecular Formula | C17H21FN8O3 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [3-fluoro-2-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | COc1ncc(N2CCN(c3nccc(COC(=O)N=C(N)N)c3F)CC2)cn1 |
| InChI | InChI=1S/C17H21FN8O3/c1-28-16-22-8-12(9-23-16)25-4-6-26(7-5-25)14-13(18)11(2-3-21-14)10-29-17(27)24-15(19)20/h2-3,8-9H,4-7,10H2,1H3,(H4,19,20,24,27) |
| InChIKey | QSRPLOSGHQNCID-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 145.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|