C20H25FN6O2 — CID 146028290
[2-[4-(2,6-dimethylphenyl)piperazin-1-yl]-3-fluoro-4-pyridinyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146028290) has the molecular formula C20H25FN6O2 and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-[4-(2,6-dimethylphenyl)piperazin-1-yl]-3-fluoro-4-pyridinyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-[4-(2,6-dimethylphenyl)piperazin-1-yl]-3-fluoro-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146028290 |
| Molecular Formula | C20H25FN6O2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [2-[4-(2,6-dimethylphenyl)piperazin-1-yl]-3-fluoro-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | Cc1cccc(C)c1N1CCN(c2nccc(COC(=O)N=C(N)N)c2F)CC1 |
| InChI | InChI=1S/C20H25FN6O2/c1-13-4-3-5-14(2)17(13)26-8-10-27(11-9-26)18-16(21)15(6-7-24-18)12-29-20(28)25-19(22)23/h3-7H,8-12H2,1-2H3,(H4,22,23,25,28) |
| InChIKey | PAWSPSHSESETCV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|