C19H23FN8O3 — CID 146028280
[3-fluoro-2-[4-[5-(methylcarbamoyl)-2-pyridinyl]piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146028280) has the molecular formula C19H23FN8O3 and a molecular weight of 430.44 g/mol. Its IUPAC name is [3-fluoro-2-[4-[5-(methylcarbamoyl)-2-pyridinyl]piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-fluoro-2-[4-[5-(methylcarbamoyl)-2-pyridinyl]piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146028280 |
| Molecular Formula | C19H23FN8O3 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [3-fluoro-2-[4-[5-(methylcarbamoyl)-2-pyridinyl]piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CNC(=O)c1ccc(N2CCN(c3nccc(COC(=O)N=C(N)N)c3F)CC2)nc1 |
| InChI | InChI=1S/C19H23FN8O3/c1-23-17(29)12-2-3-14(25-10-12)27-6-8-28(9-7-27)16-15(20)13(4-5-24-16)11-31-19(30)26-18(21)22/h2-5,10H,6-9,11H2,1H3,(H,23,29)(H4,21,22,26,30) |
| InChIKey | SYPUWCJEBZLHBX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|